C10H17N3O5S2 — CID 60716095
N-(2-methoxyethyl)-2-[methyl-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonyl]amino]acetamide (PubChem CID 60716095) has the molecular formula C10H17N3O5S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[methyl-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonyl]amino]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[methyl-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonyl]amino]acetamide |
|---|---|
| PubChem CID | 60716095 |
| Molecular Formula | C10H17N3O5S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-(2-methoxyethyl)-2-[methyl-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonyl]amino]acetamide |
| SMILES | COCCNC(=O)CN(C)S(=O)(=O)c1sc(=O)[nH]c1C |
| InChI | InChI=1S/C10H17N3O5S2/c1-7-9(19-10(15)12-7)20(16,17)13(2)6-8(14)11-4-5-18-3/h4-6H2,1-3H3,(H,11,14)(H,12,15) |
| InChIKey | OCPUGDDMWXJAPN-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|