C17H24N4O7S — CID 42961175
N-(2-methoxyethyl)-2-[[4-methoxy-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]sulfonyl-methylamino]acetamide (PubChem CID 42961175) has the molecular formula C17H24N4O7S and a molecular weight of 428.47 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[4-methoxy-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]sulfonyl-methylamino]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[[4-methoxy-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 42961175 |
| Molecular Formula | C17H24N4O7S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[4-methoxy-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]sulfonyl-methylamino]acetamide |
| SMILES | COCCNC(=O)CN(C)S(=O)(=O)c1ccc(OC)c(C2(C)NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C17H24N4O7S/c1-17(15(23)19-16(24)20-17)12-9-11(5-6-13(12)28-4)29(25,26)21(2)10-14(22)18-7-8-27-3/h5-6,9H,7-8,10H2,1-4H3,(H,18,22)(H2,19,20,23,24) |
| InChIKey | UMZDWFRFOYYCHP-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|