C12H17BrN2O4S — CID 47256526
2-[(3-bromo-4-methoxyphenyl)sulfonyl-methylamino]-N-ethylacetamide (PubChem CID 47256526) has the molecular formula C12H17BrN2O4S and a molecular weight of 365.25 g/mol. Its IUPAC name is 2-[(3-bromo-4-methoxyphenyl)sulfonyl-methylamino]-N-ethylacetamide.
| Compound Name | 2-[(3-bromo-4-methoxyphenyl)sulfonyl-methylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 47256526 |
| Molecular Formula | C12H17BrN2O4S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 2-[(3-bromo-4-methoxyphenyl)sulfonyl-methylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(C)S(=O)(=O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C12H17BrN2O4S/c1-4-14-12(16)8-15(2)20(17,18)9-5-6-11(19-3)10(13)7-9/h5-7H,4,8H2,1-3H3,(H,14,16) |
| InChIKey | YNWMLBMCVDWRAN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |