C13H20BrNO3S — CID 61060027
3-bromo-4-methoxy-N-methyl-N-(3-methylbutyl)benzenesulfonamide (PubChem CID 61060027) has the molecular formula C13H20BrNO3S and a molecular weight of 350.28 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-methyl-N-(3-methylbutyl)benzenesulfonamide.
| Compound Name | 3-bromo-4-methoxy-N-methyl-N-(3-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61060027 |
| Molecular Formula | C13H20BrNO3S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 3-bromo-4-methoxy-N-methyl-N-(3-methylbutyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CCC(C)C)cc1Br |
| InChI | InChI=1S/C13H20BrNO3S/c1-10(2)7-8-15(3)19(16,17)11-5-6-13(18-4)12(14)9-11/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | LUPIDUQZVUXVHF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |