C14H16BrNO3S2 — CID 60652342
3-bromo-4-methoxy-N-methyl-N-[(3-methylthiophen-2-yl)methyl]benzenesulfonamide (PubChem CID 60652342) has the molecular formula C14H16BrNO3S2 and a molecular weight of 390.32 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-methyl-N-[(3-methylthiophen-2-yl)methyl]benzenesulfonamide.
| Compound Name | 3-bromo-4-methoxy-N-methyl-N-[(3-methylthiophen-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60652342 |
| Molecular Formula | C14H16BrNO3S2 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 3-bromo-4-methoxy-N-methyl-N-[(3-methylthiophen-2-yl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)Cc2sccc2C)cc1Br |
| InChI | InChI=1S/C14H16BrNO3S2/c1-10-6-7-20-14(10)9-16(2)21(17,18)11-4-5-13(19-3)12(15)8-11/h4-8H,9H2,1-3H3 |
| InChIKey | BJALZLHECLFXFM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |