C13H21NO5S — CID 115741211
N-(3-hydroxybutyl)-3,4-dimethoxy-N-methylbenzenesulfonamide (PubChem CID 115741211) has the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-3,4-dimethoxy-N-methylbenzenesulfonamide.
| Compound Name | N-(3-hydroxybutyl)-3,4-dimethoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 115741211 |
| Molecular Formula | C13H21NO5S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-(3-hydroxybutyl)-3,4-dimethoxy-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CCC(C)O)cc1OC |
| InChI | InChI=1S/C13H21NO5S/c1-10(15)7-8-14(2)20(16,17)11-5-6-12(18-3)13(9-11)19-4/h5-6,9-10,15H,7-8H2,1-4H3 |
| InChIKey | QXQWAWFLBCFCNC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |