C13H20N2O5S — CID 45371745
2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-ethylacetamide (PubChem CID 45371745) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-ethylacetamide.
| Compound Name | 2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 45371745 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(C)S(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H20N2O5S/c1-5-14-13(16)9-15(2)21(17,18)12-8-10(19-3)6-7-11(12)20-4/h6-8H,5,9H2,1-4H3,(H,14,16) |
| InChIKey | YCTAFVKRBLMBPD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |