C18H30N3O5S+ — CID 7421417
2-[(4-methoxy-3-methylphenyl)sulfonyl-methylamino]-N-(3-morpholin-4-ium-4-ylpropyl)acetamide (PubChem CID 7421417) has the molecular formula C18H30N3O5S+ and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[(4-methoxy-3-methylphenyl)sulfonyl-methylamino]-N-(3-morpholin-4-ium-4-ylpropyl)acetamide.
| Compound Name | 2-[(4-methoxy-3-methylphenyl)sulfonyl-methylamino]-N-(3-morpholin-4-ium-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 7421417 |
| Molecular Formula | C18H30N3O5S+ |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[(4-methoxy-3-methylphenyl)sulfonyl-methylamino]-N-(3-morpholin-4-ium-4-ylpropyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC(=O)NCCC[NH+]2CCOCC2)cc1C |
| InChI | InChI=1S/C18H29N3O5S/c1-15-13-16(5-6-17(15)25-3)27(23,24)20(2)14-18(22)19-7-4-8-21-9-11-26-12-10-21/h5-6,13H,4,7-12,14H2,1-3H3,(H,19,22)/p+1 |
| InChIKey | RESKYUORJDTQJN-UHFFFAOYSA-O |
| XLogP | -0.95 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|