C18H29N3O5S — CID 92645558
2-[ethyl-(4-methoxy-3-methylphenyl)sulfonylamino]-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 92645558) has the molecular formula C18H29N3O5S and a molecular weight of 399.51 g/mol. Its IUPAC name is 2-[ethyl-(4-methoxy-3-methylphenyl)sulfonylamino]-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-[ethyl-(4-methoxy-3-methylphenyl)sulfonylamino]-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 92645558 |
| Molecular Formula | C18H29N3O5S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-[ethyl-(4-methoxy-3-methylphenyl)sulfonylamino]-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | CCN(CC(=O)NCCN1CCOCC1)S(=O)(=O)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C18H29N3O5S/c1-4-21(14-18(22)19-7-8-20-9-11-26-12-10-20)27(23,24)16-5-6-17(25-3)15(2)13-16/h5-6,13H,4,7-12,14H2,1-3H3,(H,19,22) |
| InChIKey | RSFBVPXJXADLEN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |