C17H24N4O5S — CID 119966018
4-methoxy-N-methyl-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-piperidin-4-ylbenzenesulfonamide (PubChem CID 119966018) has the molecular formula C17H24N4O5S and a molecular weight of 396.47 g/mol. Its IUPAC name is 4-methoxy-N-methyl-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-piperidin-4-ylbenzenesulfonamide.
| Compound Name | 4-methoxy-N-methyl-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-piperidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 119966018 |
| Molecular Formula | C17H24N4O5S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 4-methoxy-N-methyl-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-piperidin-4-ylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)C2CCNCC2)cc1C1(C)NC(=O)NC1=O |
| InChI | InChI=1S/C17H24N4O5S/c1-17(15(22)19-16(23)20-17)13-10-12(4-5-14(13)26-3)27(24,25)21(2)11-6-8-18-9-7-11/h4-5,10-11,18H,6-9H2,1-3H3,(H2,19,20,22,23) |
| InChIKey | YZFIQELUKQTFNC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|