C14H19ClN2O6S — CID 30872480
methyl 4-chloro-3-[[2-(2-methoxyethylamino)-2-oxoethyl]-methylsulfamoyl]benzoate (PubChem CID 30872480) has the molecular formula C14H19ClN2O6S and a molecular weight of 378.83 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(2-methoxyethylamino)-2-oxoethyl]-methylsulfamoyl]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(2-methoxyethylamino)-2-oxoethyl]-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 30872480 |
| Molecular Formula | C14H19ClN2O6S |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | methyl 4-chloro-3-[[2-(2-methoxyethylamino)-2-oxoethyl]-methylsulfamoyl]benzoate |
| SMILES | COCCNC(=O)CN(C)S(=O)(=O)c1cc(C(=O)OC)ccc1Cl |
| InChI | InChI=1S/C14H19ClN2O6S/c1-17(9-13(18)16-6-7-22-2)24(20,21)12-8-10(14(19)23-3)4-5-11(12)15/h4-5,8H,6-7,9H2,1-3H3,(H,16,18) |
| InChIKey | OLPJVMIHWINPST-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|