C14H18ClNO4S — CID 52575980
methyl 4-chloro-3-[ethyl(2-methylprop-2-enyl)sulfamoyl]benzoate (PubChem CID 52575980) has the molecular formula C14H18ClNO4S and a molecular weight of 331.82 g/mol. Its IUPAC name is methyl 4-chloro-3-[ethyl(2-methylprop-2-enyl)sulfamoyl]benzoate.
| Compound Name | methyl 4-chloro-3-[ethyl(2-methylprop-2-enyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 52575980 |
| Molecular Formula | C14H18ClNO4S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | methyl 4-chloro-3-[ethyl(2-methylprop-2-enyl)sulfamoyl]benzoate |
| SMILES | C=C(C)CN(CC)S(=O)(=O)c1cc(C(=O)OC)ccc1Cl |
| InChI | InChI=1S/C14H18ClNO4S/c1-5-16(9-10(2)3)21(18,19)13-8-11(14(17)20-4)6-7-12(13)15/h6-8H,2,5,9H2,1,3-4H3 |
| InChIKey | RSMBVQMERTYIBZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|