C16H21NO6S — CID 31481427
dimethyl 5-[ethyl(2-methylprop-2-enyl)sulfamoyl]benzene-1,3-dicarboxylate (PubChem CID 31481427) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is dimethyl 5-[ethyl(2-methylprop-2-enyl)sulfamoyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[ethyl(2-methylprop-2-enyl)sulfamoyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 31481427 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | dimethyl 5-[ethyl(2-methylprop-2-enyl)sulfamoyl]benzene-1,3-dicarboxylate |
| SMILES | C=C(C)CN(CC)S(=O)(=O)c1cc(C(=O)OC)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C16H21NO6S/c1-6-17(10-11(2)3)24(20,21)14-8-12(15(18)22-4)7-13(9-14)16(19)23-5/h7-9H,2,6,10H2,1,3-5H3 |
| InChIKey | FCUBMKLNZHRODO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|