C13H17NO9S2 — CID 21429819
2-[[3,5-bis(methoxycarbonyl)phenyl]sulfonyl-methylamino]ethanesulfonic acid (PubChem CID 21429819) has the molecular formula C13H17NO9S2 and a molecular weight of 395.41 g/mol. Its IUPAC name is 2-[[3,5-bis(methoxycarbonyl)phenyl]sulfonyl-methylamino]ethanesulfonic acid.
| Compound Name | 2-[[3,5-bis(methoxycarbonyl)phenyl]sulfonyl-methylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 21429819 |
| Molecular Formula | C13H17NO9S2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 2-[[3,5-bis(methoxycarbonyl)phenyl]sulfonyl-methylamino]ethanesulfonic acid |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)N(C)CCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C13H17NO9S2/c1-14(4-5-24(17,18)19)25(20,21)11-7-9(12(15)22-2)6-10(8-11)13(16)23-3/h6-8H,4-5H2,1-3H3,(H,17,18,19) |
| InChIKey | GXTAWXDBIWDTJM-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|