C16H21ClN2O5 — CID 113176515
methyl 3-[acetyl-[2-(3-methoxypropylamino)-2-oxoethyl]amino]-4-chlorobenzoate (PubChem CID 113176515) has the molecular formula C16H21ClN2O5 and a molecular weight of 356.81 g/mol. Its IUPAC name is methyl 3-[acetyl-[2-(3-methoxypropylamino)-2-oxoethyl]amino]-4-chlorobenzoate.
| Compound Name | methyl 3-[acetyl-[2-(3-methoxypropylamino)-2-oxoethyl]amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 113176515 |
| Molecular Formula | C16H21ClN2O5 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | methyl 3-[acetyl-[2-(3-methoxypropylamino)-2-oxoethyl]amino]-4-chlorobenzoate |
| SMILES | COCCCNC(=O)CN(C(C)=O)c1cc(C(=O)OC)ccc1Cl |
| InChI | InChI=1S/C16H21ClN2O5/c1-11(20)19(10-15(21)18-7-4-8-23-2)14-9-12(16(22)24-3)5-6-13(14)17/h5-6,9H,4,7-8,10H2,1-3H3,(H,18,21) |
| InChIKey | KPKQMMKHEIZSID-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|