C17H24ClN3O4 — CID 113131601
methyl 3-[acetyl-[3-[2-(dimethylamino)ethylamino]-3-oxopropyl]amino]-4-chlorobenzoate (PubChem CID 113131601) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is methyl 3-[acetyl-[3-[2-(dimethylamino)ethylamino]-3-oxopropyl]amino]-4-chlorobenzoate.
| Compound Name | methyl 3-[acetyl-[3-[2-(dimethylamino)ethylamino]-3-oxopropyl]amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 113131601 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | methyl 3-[acetyl-[3-[2-(dimethylamino)ethylamino]-3-oxopropyl]amino]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(N(CCC(=O)NCCN(C)C)C(C)=O)c1 |
| InChI | InChI=1S/C17H24ClN3O4/c1-12(22)21(9-7-16(23)19-8-10-20(2)3)15-11-13(17(24)25-4)5-6-14(15)18/h5-6,11H,7-10H2,1-4H3,(H,19,23) |
| InChIKey | SRWBDKJEHOETOA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |