C15H19ClN2O4 — CID 113062084
methyl 3-[acetyl-[2-(propanoylamino)ethyl]amino]-4-chlorobenzoate (PubChem CID 113062084) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is methyl 3-[acetyl-[2-(propanoylamino)ethyl]amino]-4-chlorobenzoate.
| Compound Name | methyl 3-[acetyl-[2-(propanoylamino)ethyl]amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 113062084 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | methyl 3-[acetyl-[2-(propanoylamino)ethyl]amino]-4-chlorobenzoate |
| SMILES | CCC(=O)NCCN(C(C)=O)c1cc(C(=O)OC)ccc1Cl |
| InChI | InChI=1S/C15H19ClN2O4/c1-4-14(20)17-7-8-18(10(2)19)13-9-11(15(21)22-3)5-6-12(13)16/h5-6,9H,4,7-8H2,1-3H3,(H,17,20) |
| InChIKey | MYENRFWRIHECGG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |