C19H20ClN3O4 — CID 113062106
methyl 3-[acetyl-[2-(phenylcarbamoylamino)ethyl]amino]-4-chlorobenzoate (PubChem CID 113062106) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is methyl 3-[acetyl-[2-(phenylcarbamoylamino)ethyl]amino]-4-chlorobenzoate.
| Compound Name | methyl 3-[acetyl-[2-(phenylcarbamoylamino)ethyl]amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 113062106 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | methyl 3-[acetyl-[2-(phenylcarbamoylamino)ethyl]amino]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(N(CCNC(=O)Nc2ccccc2)C(C)=O)c1 |
| InChI | InChI=1S/C19H20ClN3O4/c1-13(24)23(17-12-14(18(25)27-2)8-9-16(17)20)11-10-21-19(26)22-15-6-4-3-5-7-15/h3-9,12H,10-11H2,1-2H3,(H2,21,22,26) |
| InChIKey | QHLOPGQFHZQKLS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |