C14H16ClNO4S2 — CID 110291167
5-chloro-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-N-methylthiophene-2-sulfonamide (PubChem CID 110291167) has the molecular formula C14H16ClNO4S2 and a molecular weight of 361.87 g/mol. Its IUPAC name is 5-chloro-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-N-methylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110291167 |
| Molecular Formula | C14H16ClNO4S2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 5-chloro-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-N-methylthiophene-2-sulfonamide |
| SMILES | COc1ccc(C(O)CN(C)S(=O)(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C14H16ClNO4S2/c1-16(22(18,19)14-8-7-13(15)21-14)9-12(17)10-3-5-11(20-2)6-4-10/h3-8,12,17H,9H2,1-2H3 |
| InChIKey | GIRGSSXTAARNLN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |