C15H18ClNO4S2 — CID 22500888
5-chloro-N-[1-hydroxy-3-(4-methoxyphenyl)butan-2-yl]thiophene-2-sulfonamide (PubChem CID 22500888) has the molecular formula C15H18ClNO4S2 and a molecular weight of 375.90 g/mol. Its IUPAC name is 5-chloro-N-[1-hydroxy-3-(4-methoxyphenyl)butan-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[1-hydroxy-3-(4-methoxyphenyl)butan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22500888 |
| Molecular Formula | C15H18ClNO4S2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 5-chloro-N-[1-hydroxy-3-(4-methoxyphenyl)butan-2-yl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(C(C)C(CO)NS(=O)(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C15H18ClNO4S2/c1-10(11-3-5-12(21-2)6-4-11)13(9-18)17-23(19,20)15-8-7-14(16)22-15/h3-8,10,13,17-18H,9H2,1-2H3 |
| InChIKey | VVEYDHBFXUWSRA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |