C14H14ClNO5S2 — CID 94187653
(2R)-N-(5-chlorothiophen-2-yl)sulfonyl-2-(4-methoxyphenoxy)propanamide (PubChem CID 94187653) has the molecular formula C14H14ClNO5S2 and a molecular weight of 375.86 g/mol. Its IUPAC name is (2R)-N-(5-chlorothiophen-2-yl)sulfonyl-2-(4-methoxyphenoxy)propanamide.
| Compound Name | (2R)-N-(5-chlorothiophen-2-yl)sulfonyl-2-(4-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 94187653 |
| Molecular Formula | C14H14ClNO5S2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | (2R)-N-(5-chlorothiophen-2-yl)sulfonyl-2-(4-methoxyphenoxy)propanamide |
| SMILES | COc1ccc(O[C@H](C)C(=O)NS(=O)(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C14H14ClNO5S2/c1-9(21-11-5-3-10(20-2)4-6-11)14(17)16-23(18,19)13-8-7-12(15)22-13/h3-9H,1-2H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | KSLRACHHRLWQPA-SECBINFHSA-N |
| XLogP | 2.68 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |