C6H7ClN2O3S2 — CID 8500723
N'-(5-chlorothiophen-2-yl)sulfonylacetohydrazide (PubChem CID 8500723) has the molecular formula C6H7ClN2O3S2 and a molecular weight of 254.72 g/mol. Its IUPAC name is N'-(5-chlorothiophen-2-yl)sulfonylacetohydrazide.
| Compound Name | N'-(5-chlorothiophen-2-yl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 8500723 |
| Molecular Formula | C6H7ClN2O3S2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | N'-(5-chlorothiophen-2-yl)sulfonylacetohydrazide |
| SMILES | CC(=O)NNS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C6H7ClN2O3S2/c1-4(10)8-9-14(11,12)6-3-2-5(7)13-6/h2-3,9H,1H3,(H,8,10) |
| InChIKey | BBATXFJEVQFFPH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|