C13H12ClN3O4S2 — CID 9239780
2-[2-(5-chlorothiophen-2-yl)sulfonylhydrazinyl]-N-(4-methylphenyl)-2-oxoacetamide (PubChem CID 9239780) has the molecular formula C13H12ClN3O4S2 and a molecular weight of 373.84 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)sulfonylhydrazinyl]-N-(4-methylphenyl)-2-oxoacetamide.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)sulfonylhydrazinyl]-N-(4-methylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 9239780 |
| Molecular Formula | C13H12ClN3O4S2 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)sulfonylhydrazinyl]-N-(4-methylphenyl)-2-oxoacetamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NNS(=O)(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C13H12ClN3O4S2/c1-8-2-4-9(5-3-8)15-12(18)13(19)16-17-23(20,21)11-7-6-10(14)22-11/h2-7,17H,1H3,(H,15,18)(H,16,19) |
| InChIKey | QLPYJXCTPCOKLK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|