C15H13ClN2O3S2 — CID 90554233
N-[4-[3-[(5-chlorothiophen-2-yl)sulfonylamino]prop-1-ynyl]phenyl]acetamide (PubChem CID 90554233) has the molecular formula C15H13ClN2O3S2 and a molecular weight of 368.87 g/mol. Its IUPAC name is N-[4-[3-[(5-chlorothiophen-2-yl)sulfonylamino]prop-1-ynyl]phenyl]acetamide.
| Compound Name | N-[4-[3-[(5-chlorothiophen-2-yl)sulfonylamino]prop-1-ynyl]phenyl]acetamide |
|---|---|
| PubChem CID | 90554233 |
| Molecular Formula | C15H13ClN2O3S2 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | N-[4-[3-[(5-chlorothiophen-2-yl)sulfonylamino]prop-1-ynyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C#CCNS(=O)(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C15H13ClN2O3S2/c1-11(19)18-13-6-4-12(5-7-13)3-2-10-17-23(20,21)15-9-8-14(16)22-15/h4-9,17H,10H2,1H3,(H,18,19) |
| InChIKey | NRXFBEFVIHJNBW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|