C17H15FN2O3S — CID 90554249
N-[4-[3-[(3-fluorophenyl)sulfonylamino]prop-1-ynyl]phenyl]acetamide (PubChem CID 90554249) has the molecular formula C17H15FN2O3S and a molecular weight of 346.38 g/mol. Its IUPAC name is N-[4-[3-[(3-fluorophenyl)sulfonylamino]prop-1-ynyl]phenyl]acetamide.
| Compound Name | N-[4-[3-[(3-fluorophenyl)sulfonylamino]prop-1-ynyl]phenyl]acetamide |
|---|---|
| PubChem CID | 90554249 |
| Molecular Formula | C17H15FN2O3S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-[4-[3-[(3-fluorophenyl)sulfonylamino]prop-1-ynyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C#CCNS(=O)(=O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C17H15FN2O3S/c1-13(21)20-16-9-7-14(8-10-16)4-3-11-19-24(22,23)17-6-2-5-15(18)12-17/h2,5-10,12,19H,11H2,1H3,(H,20,21) |
| InChIKey | CWGNTIMFRISGSD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|