C16H15ClN4O3S — CID 2000300
N-(4-acetamidophenyl)-2-[2-[1-(5-chlorothiophen-2-yl)ethenyl]hydrazinyl]-2-oxoacetamide (PubChem CID 2000300) has the molecular formula C16H15ClN4O3S and a molecular weight of 378.84 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[2-[1-(5-chlorothiophen-2-yl)ethenyl]hydrazinyl]-2-oxoacetamide.
| Compound Name | N-(4-acetamidophenyl)-2-[2-[1-(5-chlorothiophen-2-yl)ethenyl]hydrazinyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 2000300 |
| Molecular Formula | C16H15ClN4O3S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[2-[1-(5-chlorothiophen-2-yl)ethenyl]hydrazinyl]-2-oxoacetamide |
| SMILES | C=C(NNC(=O)C(=O)Nc1ccc(NC(C)=O)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H15ClN4O3S/c1-9(13-7-8-14(17)25-13)20-21-16(24)15(23)19-12-5-3-11(4-6-12)18-10(2)22/h3-8,20H,1H2,2H3,(H,18,22)(H,19,23)(H,21,24) |
| InChIKey | VDFUENOZUHJYGM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|