C13H13N5O3S — CID 9403203
N-(4-acetamidophenyl)-N'-(5-methyl-1,3,4-thiadiazol-2-yl)oxamide (PubChem CID 9403203) has the molecular formula C13H13N5O3S and a molecular weight of 319.35 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-N'-(5-methyl-1,3,4-thiadiazol-2-yl)oxamide.
| Compound Name | N-(4-acetamidophenyl)-N'-(5-methyl-1,3,4-thiadiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 9403203 |
| Molecular Formula | C13H13N5O3S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-(4-acetamidophenyl)-N'-(5-methyl-1,3,4-thiadiazol-2-yl)oxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(=O)Nc2nnc(C)s2)cc1 |
| InChI | InChI=1S/C13H13N5O3S/c1-7(19)14-9-3-5-10(6-4-9)15-11(20)12(21)16-13-18-17-8(2)22-13/h3-6H,1-2H3,(H,14,19)(H,15,20)(H,16,18,21) |
| InChIKey | HQBSDPUHGOLZBI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|