C7H8ClNO4S2 — CID 117037892
2-(5-chlorothiophen-2-yl)sulfonyl-2-(methylamino)acetic acid (PubChem CID 117037892) has the molecular formula C7H8ClNO4S2 and a molecular weight of 269.73 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)sulfonyl-2-(methylamino)acetic acid.
| Compound Name | 2-(5-chlorothiophen-2-yl)sulfonyl-2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 117037892 |
| Molecular Formula | C7H8ClNO4S2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 268.96 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)sulfonyl-2-(methylamino)acetic acid |
| SMILES | CNC(C(=O)O)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C7H8ClNO4S2/c1-9-6(7(10)11)15(12,13)5-3-2-4(8)14-5/h2-3,6,9H,1H3,(H,10,11) |
| InChIKey | COCUWDXHQRSOSI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |