C8H11ClO3S2 — CID 117037675
2-(5-chlorothiophen-2-yl)sulfonylbutan-1-ol (PubChem CID 117037675) has the molecular formula C8H11ClO3S2 and a molecular weight of 254.76 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)sulfonylbutan-1-ol.
| Compound Name | 2-(5-chlorothiophen-2-yl)sulfonylbutan-1-ol |
|---|---|
| PubChem CID | 117037675 |
| Molecular Formula | C8H11ClO3S2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)sulfonylbutan-1-ol |
| SMILES | CCC(CO)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H11ClO3S2/c1-2-6(5-10)14(11,12)8-4-3-7(9)13-8/h3-4,6,10H,2,5H2,1H3 |
| InChIKey | IKBPFIYCKLWEFK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |