C8H12ClNO2S2 — CID 117036257
3-(5-chlorothiophen-2-yl)sulfonylbutan-1-amine (PubChem CID 117036257) has the molecular formula C8H12ClNO2S2 and a molecular weight of 253.78 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)sulfonylbutan-1-amine.
| Compound Name | 3-(5-chlorothiophen-2-yl)sulfonylbutan-1-amine |
|---|---|
| PubChem CID | 117036257 |
| Molecular Formula | C8H12ClNO2S2 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)sulfonylbutan-1-amine |
| SMILES | CC(CCN)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H12ClNO2S2/c1-6(4-5-10)14(11,12)8-3-2-7(9)13-8/h2-3,6H,4-5,10H2,1H3 |
| InChIKey | SMIHCHQLHCOBLQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |