C9H14ClNO2S2 — CID 81202609
3-[(5-chlorothiophen-2-yl)methylsulfonyl]-2-methylpropan-1-amine (PubChem CID 81202609) has the molecular formula C9H14ClNO2S2 and a molecular weight of 267.80 g/mol. Its IUPAC name is 3-[(5-chlorothiophen-2-yl)methylsulfonyl]-2-methylpropan-1-amine.
| Compound Name | 3-[(5-chlorothiophen-2-yl)methylsulfonyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 81202609 |
| Molecular Formula | C9H14ClNO2S2 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 3-[(5-chlorothiophen-2-yl)methylsulfonyl]-2-methylpropan-1-amine |
| SMILES | CC(CN)CS(=O)(=O)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C9H14ClNO2S2/c1-7(4-11)5-15(12,13)6-8-2-3-9(10)14-8/h2-3,7H,4-6,11H2,1H3 |
| InChIKey | XUBKUESXTCXVPU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |