C9H14ClNS2 — CID 66224951
3-[(5-chlorothiophen-2-yl)methylsulfanyl]-2-methylpropan-1-amine (PubChem CID 66224951) has the molecular formula C9H14ClNS2 and a molecular weight of 235.80 g/mol. Its IUPAC name is 3-[(5-chlorothiophen-2-yl)methylsulfanyl]-2-methylpropan-1-amine.
| Compound Name | 3-[(5-chlorothiophen-2-yl)methylsulfanyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 66224951 |
| Molecular Formula | C9H14ClNS2 |
| Molecular Weight | 235.80 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 3-[(5-chlorothiophen-2-yl)methylsulfanyl]-2-methylpropan-1-amine |
| SMILES | CC(CN)CSCc1ccc(Cl)s1 |
| InChI | InChI=1S/C9H14ClNS2/c1-7(4-11)5-12-6-8-2-3-9(10)13-8/h2-3,7H,4-6,11H2,1H3 |
| InChIKey | YOJCYILDOXNHPN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.80 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |