C9H14ClIN2S3 — CID 173377773
methyl N'-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]ethyl]carbamimidothioate;hydroiodide (PubChem CID 173377773) has the molecular formula C9H14ClIN2S3 and a molecular weight of 408.78 g/mol. Its IUPAC name is methyl N'-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]ethyl]carbamimidothioate;hydroiodide.
| Compound Name | methyl N'-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]ethyl]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 173377773 |
| Molecular Formula | C9H14ClIN2S3 |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 407.91 |
| IUPAC Name | methyl N'-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]ethyl]carbamimidothioate;hydroiodide |
| SMILES | CS/C(N)=N\CCSCc1ccc(Cl)s1.I |
| InChI | InChI=1S/C9H13ClN2S3.HI/c1-13-9(11)12-4-5-14-6-7-2-3-8(10)15-7;/h2-3H,4-6H2,1H3,(H2,11,12);1H |
| InChIKey | RQRYLICWWZEWJS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|