C11H14ClNO3S2 — CID 62626392
2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]-methylamino]propanoic acid (PubChem CID 62626392) has the molecular formula C11H14ClNO3S2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]-methylamino]propanoic acid.
| Compound Name | 2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 62626392 |
| Molecular Formula | C11H14ClNO3S2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)CSCc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H14ClNO3S2/c1-7(11(15)16)13(2)10(14)6-17-5-8-3-4-9(12)18-8/h3-4,7H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | SFNIPDWGGDPOGB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |