C12H16ClNO3S2 — CID 62818490
2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]-methylamino]-2-methylpropanoic acid (PubChem CID 62818490) has the molecular formula C12H16ClNO3S2 and a molecular weight of 321.85 g/mol. Its IUPAC name is 2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]-methylamino]-2-methylpropanoic acid.
| Compound Name | 2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62818490 |
| Molecular Formula | C12H16ClNO3S2 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]-methylamino]-2-methylpropanoic acid |
| SMILES | CN(C(=O)CSCc1ccc(Cl)s1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H16ClNO3S2/c1-12(2,11(16)17)14(3)10(15)7-18-6-8-4-5-9(13)19-8/h4-5H,6-7H2,1-3H3,(H,16,17) |
| InChIKey | NAGWQCAZYIAXGP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |