C10H14ClNO2S2 — CID 43418794
2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-(1-hydroxypropan-2-yl)acetamide (PubChem CID 43418794) has the molecular formula C10H14ClNO2S2 and a molecular weight of 279.81 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-(1-hydroxypropan-2-yl)acetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-(1-hydroxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 43418794 |
| Molecular Formula | C10H14ClNO2S2 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-(1-hydroxypropan-2-yl)acetamide |
| SMILES | CC(CO)NC(=O)CSCc1ccc(Cl)s1 |
| InChI | InChI=1S/C10H14ClNO2S2/c1-7(4-13)12-10(14)6-15-5-8-2-3-9(11)16-8/h2-3,7,13H,4-6H2,1H3,(H,12,14) |
| InChIKey | RRHWYVJDHIXNBL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |