C8H10ClNO2S2 — CID 60701138
2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-methoxyacetamide (PubChem CID 60701138) has the molecular formula C8H10ClNO2S2 and a molecular weight of 251.76 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-methoxyacetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-methoxyacetamide |
|---|---|
| PubChem CID | 60701138 |
| Molecular Formula | C8H10ClNO2S2 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-methoxyacetamide |
| SMILES | CONC(=O)CSCc1ccc(Cl)s1 |
| InChI | InChI=1S/C8H10ClNO2S2/c1-12-10-8(11)5-13-4-6-2-3-7(9)14-6/h2-3H,4-5H2,1H3,(H,10,11) |
| InChIKey | GTGGACXMJIMYFY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|