C12H12ClNO3S2 — CID 9331463
[2-oxo-2-(prop-2-ynylamino)ethyl] 2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetate (PubChem CID 9331463) has the molecular formula C12H12ClNO3S2 and a molecular weight of 317.82 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 9331463 |
| Molecular Formula | C12H12ClNO3S2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetate |
| SMILES | C#CCNC(=O)COC(=O)CSCc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H12ClNO3S2/c1-2-5-14-11(15)6-17-12(16)8-18-7-9-3-4-10(13)19-9/h1,3-4H,5-8H2,(H,14,15) |
| InChIKey | ISRTZJILROCEGJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|