C15H17ClN2O3S3 — CID 8623417
2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 8623417) has the molecular formula C15H17ClN2O3S3 and a molecular weight of 404.97 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8623417 |
| Molecular Formula | C15H17ClN2O3S3 |
| Molecular Weight | 404.97 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CSCc2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C15H17ClN2O3S3/c16-14-6-3-12(23-14)9-22-10-15(19)18-8-7-11-1-4-13(5-2-11)24(17,20)21/h1-6H,7-10H2,(H,18,19)(H2,17,20,21) |
| InChIKey | XHHHYUMTPVFALC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.97 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |