C18H19N3O3S2 — CID 55753204
2-[(4-cyanophenyl)methylsulfanyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 55753204) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylsulfanyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[(4-cyanophenyl)methylsulfanyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55753204 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 2-[(4-cyanophenyl)methylsulfanyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | N#Cc1ccc(CSCC(=O)NCCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H19N3O3S2/c19-11-15-1-3-16(4-2-15)12-25-13-18(22)21-10-9-14-5-7-17(8-6-14)26(20,23)24/h1-8H,9-10,12-13H2,(H,21,22)(H2,20,23,24) |
| InChIKey | HSOFELQEGRIWQJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |