C19H20N2OS2 — CID 55741154
2-[(4-cyanophenyl)methylsulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 55741154) has the molecular formula C19H20N2OS2 and a molecular weight of 356.52 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylsulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2-[(4-cyanophenyl)methylsulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 55741154 |
| Molecular Formula | C19H20N2OS2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-[(4-cyanophenyl)methylsulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | Cc1ccc(SCCNC(=O)CSCc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C19H20N2OS2/c1-15-2-8-18(9-3-15)24-11-10-21-19(22)14-23-13-17-6-4-16(12-20)5-7-17/h2-9H,10-11,13-14H2,1H3,(H,21,22) |
| InChIKey | CPSBWFPDAQYWFE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|