C20H25NO3S2 — CID 99955364
2-(3,4-dimethoxyphenyl)sulfanyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 99955364) has the molecular formula C20H25NO3S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)sulfanyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)sulfanyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 99955364 |
| Molecular Formula | C20H25NO3S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)sulfanyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | COc1ccc(SCC(=O)NCCSCc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C20H25NO3S2/c1-15-4-6-16(7-5-15)13-25-11-10-21-20(22)14-26-17-8-9-18(23-2)19(12-17)24-3/h4-9,12H,10-11,13-14H2,1-3H3,(H,21,22) |
| InChIKey | NKWJSHXSWDFJOP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|