C19H20N2OS3 — CID 55386745
2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 55386745) has the molecular formula C19H20N2OS3 and a molecular weight of 388.58 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 55386745 |
| Molecular Formula | C19H20N2OS3 |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | Cc1ccc(SCCNC(=O)CSCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H20N2OS3/c1-14-6-8-15(9-7-14)24-11-10-20-18(22)12-23-13-19-21-16-4-2-3-5-17(16)25-19/h2-9H,10-13H2,1H3,(H,20,22) |
| InChIKey | UOSMXELGMPDZHQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|