C21H24N2OS2 — CID 55381367
4-(1,3-benzothiazol-2-yl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]butanamide (PubChem CID 55381367) has the molecular formula C21H24N2OS2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]butanamide |
|---|---|
| PubChem CID | 55381367 |
| Molecular Formula | C21H24N2OS2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]butanamide |
| SMILES | Cc1ccc(CSCCNC(=O)CCCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H24N2OS2/c1-16-9-11-17(12-10-16)15-25-14-13-22-20(24)7-4-8-21-23-18-5-2-3-6-19(18)26-21/h2-3,5-6,9-12H,4,7-8,13-15H2,1H3,(H,22,24) |
| InChIKey | LUTWINHYGOAMFC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|