C21H24N2O2S2 — CID 46557284
2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-[3-(1-phenylethoxy)propyl]acetamide (PubChem CID 46557284) has the molecular formula C21H24N2O2S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-[3-(1-phenylethoxy)propyl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-[3-(1-phenylethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 46557284 |
| Molecular Formula | C21H24N2O2S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-[3-(1-phenylethoxy)propyl]acetamide |
| SMILES | CC(OCCCNC(=O)CSCc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O2S2/c1-16(17-8-3-2-4-9-17)25-13-7-12-22-20(24)14-26-15-21-23-18-10-5-6-11-19(18)27-21/h2-6,8-11,16H,7,12-15H2,1H3,(H,22,24) |
| InChIKey | XLTSLWATWIYIGP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|