C17H17ClN2O3S2 — CID 2897719
N-[2-(4-chlorophenyl)sulfanylethyl]-2-[(4-nitrophenyl)methylsulfanyl]acetamide (PubChem CID 2897719) has the molecular formula C17H17ClN2O3S2 and a molecular weight of 396.92 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-2-[(4-nitrophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[(4-nitrophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 2897719 |
| Molecular Formula | C17H17ClN2O3S2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[(4-nitrophenyl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1ccc([N+](=O)[O-])cc1)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN2O3S2/c18-14-3-7-16(8-4-14)25-10-9-19-17(21)12-24-11-13-1-5-15(6-2-13)20(22)23/h1-8H,9-12H2,(H,19,21) |
| InChIKey | NZJRLCUXDKINOU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|