C18H18N4O4S — CID 108949699
N'-(3-cyanophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]propanediamide (PubChem CID 108949699) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is N'-(3-cyanophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]propanediamide.
| Compound Name | N'-(3-cyanophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]propanediamide |
|---|---|
| PubChem CID | 108949699 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N'-(3-cyanophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]propanediamide |
| SMILES | N#Cc1cccc(NC(=O)CC(=O)NCCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H18N4O4S/c19-12-14-2-1-3-15(10-14)22-18(24)11-17(23)21-9-8-13-4-6-16(7-5-13)27(20,25)26/h1-7,10H,8-9,11H2,(H,21,23)(H,22,24)(H2,20,25,26) |
| InChIKey | CZWFCNPBYQNVOX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 142.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|