C17H17N3O4S — CID 2714604
2-(2-cyanophenoxy)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 2714604) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 2714604 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | N#Cc1ccccc1OCC(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H17N3O4S/c18-11-14-3-1-2-4-16(14)24-12-17(21)20-10-9-13-5-7-15(8-6-13)25(19,22)23/h1-8H,9-10,12H2,(H,20,21)(H2,19,22,23) |
| InChIKey | AMYYEMWKFLQFLJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |