C17H20N2O2 — CID 2706736
2-(2-cyanophenoxy)-N-[2-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 2706736) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[2-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 2706736 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | N#Cc1ccccc1OCC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C17H20N2O2/c18-12-15-8-4-5-9-16(15)21-13-17(20)19-11-10-14-6-2-1-3-7-14/h4-6,8-9H,1-3,7,10-11,13H2,(H,19,20) |
| InChIKey | RLWKQIJVRLKEQN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|