C20H29NO2 — CID 177377392
N-[2-(cyclohexen-1-yl)ethyl]-2-(2-methyl-5-propan-2-ylphenoxy)acetamide (PubChem CID 177377392) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(2-methyl-5-propan-2-ylphenoxy)acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(2-methyl-5-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 177377392 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(2-methyl-5-propan-2-ylphenoxy)acetamide |
| SMILES | Cc1ccc(C(C)C)cc1OCC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H29NO2/c1-15(2)18-10-9-16(3)19(13-18)23-14-20(22)21-12-11-17-7-5-4-6-8-17/h7,9-10,13,15H,4-6,8,11-12,14H2,1-3H3,(H,21,22) |
| InChIKey | VPEPWBOFQOUJPZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|